C20H33FN2O2Si — CID 90005050
N-[(3S,4R,5R)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-4-fluoropiperidin-3-yl]acetamide (PubChem CID 90005050) has the molecular formula C20H33FN2O2Si and a molecular weight of 380.58 g/mol. Its IUPAC name is N-[(3S,4R,5R)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-4-fluoropiperidin-3-yl]acetamide.
| Compound Name | N-[(3S,4R,5R)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-4-fluoropiperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 90005050 |
| Molecular Formula | C20H33FN2O2Si |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | N-[(3S,4R,5R)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-4-fluoropiperidin-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1CN(Cc2ccccc2)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1F |
| InChI | InChI=1S/C20H33FN2O2Si/c1-15(24)22-17-13-23(12-16-10-8-7-9-11-16)14-18(19(17)21)25-26(5,6)20(2,3)4/h7-11,17-19H,12-14H2,1-6H3,(H,22,24)/t17-,18+,19+/m0/s1 |
| InChIKey | FPHUFVZMPVTFLL-IPMKNSEASA-N |
| XLogP | 3.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|