C19H32FNO2Si — CID 171837871
tert-butyl-[4-fluoro-1-(2-phenylmethoxyethyl)pyrrolidin-3-yl]oxy-dimethylsilane (PubChem CID 171837871) has the molecular formula C19H32FNO2Si and a molecular weight of 353.55 g/mol. Its IUPAC name is tert-butyl-[4-fluoro-1-(2-phenylmethoxyethyl)pyrrolidin-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[4-fluoro-1-(2-phenylmethoxyethyl)pyrrolidin-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 171837871 |
| Molecular Formula | C19H32FNO2Si |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | tert-butyl-[4-fluoro-1-(2-phenylmethoxyethyl)pyrrolidin-3-yl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CN(CCOCc2ccccc2)CC1F |
| InChI | InChI=1S/C19H32FNO2Si/c1-19(2,3)24(4,5)23-18-14-21(13-17(18)20)11-12-22-15-16-9-7-6-8-10-16/h6-10,17-18H,11-15H2,1-5H3 |
| InChIKey | YTLGFYVNVCJIAT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|