C20H32O4Si — CID 11382951
tert-butyl-dimethyl-[[(1S,3R,5R,6S)-1-methyl-3-(phenylmethoxymethyl)-2,7-dioxabicyclo[4.1.0]heptan-5-yl]oxy]silane (PubChem CID 11382951) has the molecular formula C20H32O4Si and a molecular weight of 364.56 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1S,3R,5R,6S)-1-methyl-3-(phenylmethoxymethyl)-2,7-dioxabicyclo[4.1.0]heptan-5-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1S,3R,5R,6S)-1-methyl-3-(phenylmethoxymethyl)-2,7-dioxabicyclo[4.1.0]heptan-5-yl]oxy]silane |
|---|---|
| PubChem CID | 11382951 |
| Molecular Formula | C20H32O4Si |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | tert-butyl-dimethyl-[[(1S,3R,5R,6S)-1-methyl-3-(phenylmethoxymethyl)-2,7-dioxabicyclo[4.1.0]heptan-5-yl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H](COCc2ccccc2)O[C@@]2(C)O[C@@H]12 |
| InChI | InChI=1S/C20H32O4Si/c1-19(2,3)25(5,6)24-17-12-16(22-20(4)18(17)23-20)14-21-13-15-10-8-7-9-11-15/h7-11,16-18H,12-14H2,1-6H3/t16-,17-,18+,20+/m1/s1 |
| InChIKey | JABYRMBDJREMNS-XSYGEPLQSA-N |
| XLogP | 4.50 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|