C20H32Br2O3Si — CID 10505813
tert-butyl-[[(2R,4S,5S,6R)-4,5-dibromo-6-(phenylmethoxymethyl)oxan-2-yl]methoxy]-dimethylsilane (PubChem CID 10505813) has the molecular formula C20H32Br2O3Si and a molecular weight of 508.37 g/mol. Its IUPAC name is tert-butyl-[[(2R,4S,5S,6R)-4,5-dibromo-6-(phenylmethoxymethyl)oxan-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2R,4S,5S,6R)-4,5-dibromo-6-(phenylmethoxymethyl)oxan-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10505813 |
| Molecular Formula | C20H32Br2O3Si |
| Molecular Weight | 508.37 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | tert-butyl-[[(2R,4S,5S,6R)-4,5-dibromo-6-(phenylmethoxymethyl)oxan-2-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1C[C@H](Br)[C@@H](Br)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C20H32Br2O3Si/c1-20(2,3)26(4,5)24-13-16-11-17(21)19(22)18(25-16)14-23-12-15-9-7-6-8-10-15/h6-10,16-19H,11-14H2,1-5H3/t16-,17+,18-,19-/m1/s1 |
| InChIKey | WXOJYCSJGWIDJG-FCGDIQPGSA-N |
| XLogP | 5.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.37 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|