C39H54O10Si — CID 56636116
(2S,3R,4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[(2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyoxane-2,4-diol (PubChem CID 56636116) has the molecular formula C39H54O10Si and a molecular weight of 710.94 g/mol. Its IUPAC name is (2S,3R,4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[(2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyoxane-2,4-diol.
| Compound Name | (2S,3R,4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[(2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyoxane-2,4-diol |
|---|---|
| PubChem CID | 56636116 |
| Molecular Formula | C39H54O10Si |
| Molecular Weight | 710.94 g/mol |
| Exact Mass | 710.35 |
| IUPAC Name | (2S,3R,4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[(2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyoxane-2,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1C[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)[C@@H](O)O1 |
| InChI | InChI=1S/C39H54O10Si/c1-39(2,3)50(4,5)46-26-30-21-31(41)33(37(42)47-30)49-38-36(45-25-29-19-13-8-14-20-29)35(44-24-28-17-11-7-12-18-28)34(32(22-40)48-38)43-23-27-15-9-6-10-16-27/h6-20,30-38,40-42H,21-26H2,1-5H3/t30-,31-,32+,33+,34+,35-,36+,37-,38+/m0/s1 |
| InChIKey | BRXDOHDSKKKHMI-DFOKHMJSSA-N |
| XLogP | 5.34 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.94 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|