C30H44O5Si — CID 102251588
tert-butyl-dimethyl-[[(2S,4R,5S)-4-phenylmethoxy-5-[(2S,5S)-5-(phenylmethoxymethyl)oxolan-2-yl]oxolan-2-yl]methoxy]silane (PubChem CID 102251588) has the molecular formula C30H44O5Si and a molecular weight of 512.76 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2S,4R,5S)-4-phenylmethoxy-5-[(2S,5S)-5-(phenylmethoxymethyl)oxolan-2-yl]oxolan-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2S,4R,5S)-4-phenylmethoxy-5-[(2S,5S)-5-(phenylmethoxymethyl)oxolan-2-yl]oxolan-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 102251588 |
| Molecular Formula | C30H44O5Si |
| Molecular Weight | 512.76 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | tert-butyl-dimethyl-[[(2S,4R,5S)-4-phenylmethoxy-5-[(2S,5S)-5-(phenylmethoxymethyl)oxolan-2-yl]oxolan-2-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1C[C@@H](OCc2ccccc2)[C@@H]([C@@H]2CC[C@@H](COCc3ccccc3)O2)O1 |
| InChI | InChI=1S/C30H44O5Si/c1-30(2,3)36(4,5)33-22-26-18-28(32-20-24-14-10-7-11-15-24)29(35-26)27-17-16-25(34-27)21-31-19-23-12-8-6-9-13-23/h6-15,25-29H,16-22H2,1-5H3/t25-,26-,27-,28+,29+/m0/s1 |
| InChIKey | YQWUPSNIQSXRMC-OTJWULCMSA-N |
| XLogP | 6.52 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.76 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|