C32H42O5Si — CID 67584239
2-[(2S,3R,4S,6S)-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethyl-trimethylsilane (PubChem CID 67584239) has the molecular formula C32H42O5Si and a molecular weight of 534.77 g/mol. Its IUPAC name is 2-[(2S,3R,4S,6S)-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethyl-trimethylsilane.
| Compound Name | 2-[(2S,3R,4S,6S)-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethyl-trimethylsilane |
|---|---|
| PubChem CID | 67584239 |
| Molecular Formula | C32H42O5Si |
| Molecular Weight | 534.77 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | 2-[(2S,3R,4S,6S)-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCO[C@H]1O[C@H](COCc2ccccc2)C[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H42O5Si/c1-38(2,3)20-19-34-32-31(36-24-28-17-11-6-12-18-28)30(35-23-27-15-9-5-10-16-27)21-29(37-32)25-33-22-26-13-7-4-8-14-26/h4-18,29-32H,19-25H2,1-3H3/t29-,30-,31+,32-/m0/s1 |
| InChIKey | SKAYQRIPDASURC-IHZBLBIESA-N |
| XLogP | 6.84 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.77 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|