C22H28O5 — CID 70223626
(2S,3R,4S,6S)-2-methoxy-6-(methoxymethyl)-3,4-bis(phenylmethoxy)oxane (PubChem CID 70223626) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is (2S,3R,4S,6S)-2-methoxy-6-(methoxymethyl)-3,4-bis(phenylmethoxy)oxane.
| Compound Name | (2S,3R,4S,6S)-2-methoxy-6-(methoxymethyl)-3,4-bis(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 70223626 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (2S,3R,4S,6S)-2-methoxy-6-(methoxymethyl)-3,4-bis(phenylmethoxy)oxane |
| SMILES | COC[C@@H]1C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](OC)O1 |
| InChI | InChI=1S/C22H28O5/c1-23-16-19-13-20(25-14-17-9-5-3-6-10-17)21(22(24-2)27-19)26-15-18-11-7-4-8-12-18/h3-12,19-22H,13-16H2,1-2H3/t19-,20-,21+,22-/m0/s1 |
| InChIKey | MBQRMGPGSKHJPW-KJJMTIBFSA-N |
| XLogP | 3.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |