C30H34O5 — CID 70186984
(2S,3R,4S,6S)-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxane (PubChem CID 70186984) has the molecular formula C30H34O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is (2S,3R,4S,6S)-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxane.
| Compound Name | (2S,3R,4S,6S)-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxane |
|---|---|
| PubChem CID | 70186984 |
| Molecular Formula | C30H34O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | (2S,3R,4S,6S)-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxane |
| SMILES | C=CCO[C@H]1O[C@H](COCc2ccccc2)C[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H34O5/c1-2-18-32-30-29(34-22-26-16-10-5-11-17-26)28(33-21-25-14-8-4-9-15-25)19-27(35-30)23-31-20-24-12-6-3-7-13-24/h2-17,27-30H,1,18-23H2/t27-,28-,29+,30-/m0/s1 |
| InChIKey | YCCITKDZWRAPOL-ZXYZSCNASA-N |
| XLogP | 5.69 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|