C21H26O3 — CID 71106611
(4R,6S)-2-methyl-4-phenylmethoxy-6-(phenylmethoxymethyl)oxane (PubChem CID 71106611) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (4R,6S)-2-methyl-4-phenylmethoxy-6-(phenylmethoxymethyl)oxane.
| Compound Name | (4R,6S)-2-methyl-4-phenylmethoxy-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 71106611 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (4R,6S)-2-methyl-4-phenylmethoxy-6-(phenylmethoxymethyl)oxane |
| SMILES | CC1C[C@@H](OCc2ccccc2)C[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C21H26O3/c1-17-12-20(23-15-19-10-6-3-7-11-19)13-21(24-17)16-22-14-18-8-4-2-5-9-18/h2-11,17,20-21H,12-16H2,1H3/t17?,20-,21+/m1/s1 |
| InChIKey | QBDHBLAHIIUDSS-SJRAPUSDSA-N |
| XLogP | 4.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |