C12H16O2 — CID 25180326
(2S,4S)-2-methyl-4-phenylmethoxyoxolane (PubChem CID 25180326) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (2S,4S)-2-methyl-4-phenylmethoxyoxolane.
| Compound Name | (2S,4S)-2-methyl-4-phenylmethoxyoxolane |
|---|---|
| PubChem CID | 25180326 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (2S,4S)-2-methyl-4-phenylmethoxyoxolane |
| SMILES | C[C@H]1C[C@H](OCc2ccccc2)CO1 |
| InChI | InChI=1S/C12H16O2/c1-10-7-12(9-13-10)14-8-11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3/t10-,12-/m0/s1 |
| InChIKey | XZFZNGGXHKYHPF-JQWIXIFHSA-N |
| XLogP | 2.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |