C14H18O2 — CID 134931553
(2S,4S)-4-phenylmethoxy-2-prop-2-enyloxolane (PubChem CID 134931553) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (2S,4S)-4-phenylmethoxy-2-prop-2-enyloxolane.
| Compound Name | (2S,4S)-4-phenylmethoxy-2-prop-2-enyloxolane |
|---|---|
| PubChem CID | 134931553 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (2S,4S)-4-phenylmethoxy-2-prop-2-enyloxolane |
| SMILES | C=CC[C@H]1C[C@H](OCc2ccccc2)CO1 |
| InChI | InChI=1S/C14H18O2/c1-2-6-13-9-14(11-16-13)15-10-12-7-4-3-5-8-12/h2-5,7-8,13-14H,1,6,9-11H2/t13-,14-/m0/s1 |
| InChIKey | XGVNWKJGQJKTHJ-KBPBESRZSA-N |
| XLogP | 2.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|