C19H24O4 — CID 165116967
(2S,3R,5S)-5-[(2E)-2-ethenylpenta-2,4-dienoxy]-3-phenylmethoxyoxan-2-ol (PubChem CID 165116967) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (2S,3R,5S)-5-[(2E)-2-ethenylpenta-2,4-dienoxy]-3-phenylmethoxyoxan-2-ol.
| Compound Name | (2S,3R,5S)-5-[(2E)-2-ethenylpenta-2,4-dienoxy]-3-phenylmethoxyoxan-2-ol |
|---|---|
| PubChem CID | 165116967 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (2S,3R,5S)-5-[(2E)-2-ethenylpenta-2,4-dienoxy]-3-phenylmethoxyoxan-2-ol |
| SMILES | C=C/C=C(\C=C)CO[C@@H]1CO[C@H](O)[C@H](OCc2ccccc2)C1 |
| InChI | InChI=1S/C19H24O4/c1-3-8-15(4-2)12-21-17-11-18(19(20)23-14-17)22-13-16-9-6-5-7-10-16/h3-10,17-20H,1-2,11-14H2/b15-8+/t17-,18+,19-/m0/s1 |
| InChIKey | TZWVJTCEIUIDTR-OHUCQYDDSA-N |
| XLogP | 2.99 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|