C18H24O4 — CID 145051460
(3S)-3-[(2E)-2-ethenylpenta-2,4-dienoxy]oxolan-2-ol;phenylmethanol (PubChem CID 145051460) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is (3S)-3-[(2E)-2-ethenylpenta-2,4-dienoxy]oxolan-2-ol;phenylmethanol.
| Compound Name | (3S)-3-[(2E)-2-ethenylpenta-2,4-dienoxy]oxolan-2-ol;phenylmethanol |
|---|---|
| PubChem CID | 145051460 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (3S)-3-[(2E)-2-ethenylpenta-2,4-dienoxy]oxolan-2-ol;phenylmethanol |
| SMILES | C=C/C=C(\C=C)CO[C@H]1CCOC1O.OCc1ccccc1 |
| InChI | InChI=1S/C11H16O3.C7H8O/c1-3-5-9(4-2)8-14-10-6-7-13-11(10)12;8-6-7-4-2-1-3-5-7/h3-5,10-12H,1-2,6-8H2;1-5,8H,6H2/b9-5+;/t10-,11?;/m0./s1 |
| InChIKey | VMDBPNHVGMZXGM-FYLXCWFOSA-N |
| XLogP | 2.59 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|