About (2S,3S)-3-benzyloxolan-2-ol
(2S,3S)-3-benzyloxolan-2-ol (PubChem CID 86339403) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is (2S,3S)-3-benzyloxolan-2-ol.
Molecular Properties
| Compound Name | (2S,3S)-3-benzyloxolan-2-ol |
| PubChem CID | 86339403 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (2S,3S)-3-benzyloxolan-2-ol |
| SMILES | O[C@H]1OCC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C11H14O2/c12-11-10(6-7-13-11)8-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2/t10-,11+/m1/s1 |
| InChIKey | DEIMECHUASAHLK-MNOVXSKESA-N |
| XLogP | 1.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,3S)-3-benzyloxolan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-3-benzyloxolan-2-ol?
The IUPAC name of (2S,3S)-3-benzyloxolan-2-ol (CID 86339403) is (2S,3S)-3-benzyloxolan-2-ol.
What is the SMILES notation for (2S,3S)-3-benzyloxolan-2-ol?
The canonical SMILES for (2S,3S)-3-benzyloxolan-2-ol is O[C@H]1OCC[C@@H]1Cc1ccccc1.
What is the InChIKey of (2S,3S)-3-benzyloxolan-2-ol?
The InChIKey is DEIMECHUASAHLK-MNOVXSKESA-N. The full InChI is InChI=1S/C11H14O2/c12-11-10(6-7-13-11)8-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2/t10-,11+/m1/s1.
What are the key properties of (2S,3S)-3-benzyloxolan-2-ol?
(2S,3S)-3-benzyloxolan-2-ol has a molecular weight of 178.23 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-benzyloxolan-2-ol is sourced from PubChem (CID 86339403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).