C11H14O2 — CID 86339403
(2S,3S)-3-benzyloxolan-2-ol (PubChem CID 86339403) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (2S,3S)-3-benzyloxolan-2-ol.
| Compound Name | (2S,3S)-3-benzyloxolan-2-ol |
|---|---|
| PubChem CID | 86339403 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (2S,3S)-3-benzyloxolan-2-ol |
| SMILES | O[C@H]1OCC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C11H14O2/c12-11-10(6-7-13-11)8-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2/t10-,11+/m1/s1 |
| InChIKey | DEIMECHUASAHLK-MNOVXSKESA-N |
| XLogP | 1.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |