About 4-benzyloxolan-3-ol
4-benzyloxolan-3-ol (PubChem CID 14785279) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 4-benzyloxolan-3-ol.
Molecular Properties
| Compound Name | 4-benzyloxolan-3-ol |
| PubChem CID | 14785279 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 4-benzyloxolan-3-ol |
| SMILES | OC1COCC1Cc1ccccc1 |
| InChI | InChI=1S/C11H14O2/c12-11-8-13-7-10(11)6-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2 |
| InChIKey | DBSHHWVKURKFCT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-benzyloxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyloxolan-3-ol?
The IUPAC name of 4-benzyloxolan-3-ol (CID 14785279) is 4-benzyloxolan-3-ol.
What is the SMILES notation for 4-benzyloxolan-3-ol?
The canonical SMILES for 4-benzyloxolan-3-ol is OC1COCC1Cc1ccccc1.
What is the InChIKey of 4-benzyloxolan-3-ol?
The InChIKey is DBSHHWVKURKFCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c12-11-8-13-7-10(11)6-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2.
What are the key properties of 4-benzyloxolan-3-ol?
4-benzyloxolan-3-ol has a molecular weight of 178.23 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyloxolan-3-ol is sourced from PubChem (CID 14785279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).