C12H16O2 — CID 12704146
5-benzyl-4-methyl-1,3-dioxane (PubChem CID 12704146) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 5-benzyl-4-methyl-1,3-dioxane.
| Compound Name | 5-benzyl-4-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 12704146 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 5-benzyl-4-methyl-1,3-dioxane |
| SMILES | CC1OCOCC1Cc1ccccc1 |
| InChI | InChI=1S/C12H16O2/c1-10-12(8-13-9-14-10)7-11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3 |
| InChIKey | BSEBSQBMWAEYIS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |