C18H19BrO2 — CID 171383633
(4R,5R)-4-(2-bromophenyl)-5-[(4-methylphenyl)methyl]-1,3-dioxane (PubChem CID 171383633) has the molecular formula C18H19BrO2 and a molecular weight of 347.25 g/mol. Its IUPAC name is (4R,5R)-4-(2-bromophenyl)-5-[(4-methylphenyl)methyl]-1,3-dioxane.
| Compound Name | (4R,5R)-4-(2-bromophenyl)-5-[(4-methylphenyl)methyl]-1,3-dioxane |
|---|---|
| PubChem CID | 171383633 |
| Molecular Formula | C18H19BrO2 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | (4R,5R)-4-(2-bromophenyl)-5-[(4-methylphenyl)methyl]-1,3-dioxane |
| SMILES | Cc1ccc(C[C@@H]2COCO[C@H]2c2ccccc2Br)cc1 |
| InChI | InChI=1S/C18H19BrO2/c1-13-6-8-14(9-7-13)10-15-11-20-12-21-18(15)16-4-2-3-5-17(16)19/h2-9,15,18H,10-12H2,1H3/t15-,18-/m1/s1 |
| InChIKey | VQKYLZJESKZJLO-CRAIPNDOSA-N |
| XLogP | 4.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |