C16H23NO — CID 97176373
(3R,4R)-N-cyclopropyl-3-[(4-methylphenyl)methyl]oxan-4-amine (PubChem CID 97176373) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (3R,4R)-N-cyclopropyl-3-[(4-methylphenyl)methyl]oxan-4-amine.
| Compound Name | (3R,4R)-N-cyclopropyl-3-[(4-methylphenyl)methyl]oxan-4-amine |
|---|---|
| PubChem CID | 97176373 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (3R,4R)-N-cyclopropyl-3-[(4-methylphenyl)methyl]oxan-4-amine |
| SMILES | Cc1ccc(C[C@H]2COCC[C@H]2NC2CC2)cc1 |
| InChI | InChI=1S/C16H23NO/c1-12-2-4-13(5-3-12)10-14-11-18-9-8-16(14)17-15-6-7-15/h2-5,14-17H,6-11H2,1H3/t14-,16+/m0/s1 |
| InChIKey | QDOIBQBIIVFYMA-GOEBONIOSA-N |
| XLogP | 2.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |