C15H19Cl2NO — CID 97166611
(3S,4S)-N-cyclopropyl-3-[(2,5-dichlorophenyl)methyl]oxan-4-amine (PubChem CID 97166611) has the molecular formula C15H19Cl2NO and a molecular weight of 300.23 g/mol. Its IUPAC name is (3S,4S)-N-cyclopropyl-3-[(2,5-dichlorophenyl)methyl]oxan-4-amine.
| Compound Name | (3S,4S)-N-cyclopropyl-3-[(2,5-dichlorophenyl)methyl]oxan-4-amine |
|---|---|
| PubChem CID | 97166611 |
| Molecular Formula | C15H19Cl2NO |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (3S,4S)-N-cyclopropyl-3-[(2,5-dichlorophenyl)methyl]oxan-4-amine |
| SMILES | Clc1ccc(Cl)c(C[C@@H]2COCC[C@@H]2NC2CC2)c1 |
| InChI | InChI=1S/C15H19Cl2NO/c16-12-1-4-14(17)10(8-12)7-11-9-19-6-5-15(11)18-13-2-3-13/h1,4,8,11,13,15,18H,2-3,5-7,9H2/t11-,15+/m1/s1 |
| InChIKey | KPWMXRGTBZNCQH-ABAIWWIYSA-N |
| XLogP | 3.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |