C12H14Cl2OS — CID 97169905
(3S,4S)-3-[(2,4-dichlorophenyl)methyl]oxane-4-thiol (PubChem CID 97169905) has the molecular formula C12H14Cl2OS and a molecular weight of 277.22 g/mol. Its IUPAC name is (3S,4S)-3-[(2,4-dichlorophenyl)methyl]oxane-4-thiol.
| Compound Name | (3S,4S)-3-[(2,4-dichlorophenyl)methyl]oxane-4-thiol |
|---|---|
| PubChem CID | 97169905 |
| Molecular Formula | C12H14Cl2OS |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | (3S,4S)-3-[(2,4-dichlorophenyl)methyl]oxane-4-thiol |
| SMILES | S[C@H]1CCOC[C@@H]1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2OS/c13-10-2-1-8(11(14)6-10)5-9-7-15-4-3-12(9)16/h1-2,6,9,12,16H,3-5,7H2/t9-,12-/m0/s1 |
| InChIKey | PHOMULVILGYNCH-CABZTGNLSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|