C14H19Cl2NO3S — CID 71646877
3-[(2,4-dichlorophenyl)methyl]-N,N-dimethyloxane-4-sulfonamide (PubChem CID 71646877) has the molecular formula C14H19Cl2NO3S and a molecular weight of 352.28 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methyl]-N,N-dimethyloxane-4-sulfonamide.
| Compound Name | 3-[(2,4-dichlorophenyl)methyl]-N,N-dimethyloxane-4-sulfonamide |
|---|---|
| PubChem CID | 71646877 |
| Molecular Formula | C14H19Cl2NO3S |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methyl]-N,N-dimethyloxane-4-sulfonamide |
| SMILES | CN(C)S(=O)(=O)C1CCOCC1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2NO3S/c1-17(2)21(18,19)14-5-6-20-9-11(14)7-10-3-4-12(15)8-13(10)16/h3-4,8,11,14H,5-7,9H2,1-2H3 |
| InChIKey | YCHAPHGYUHRWAE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |