C14H20ClNO3S — CID 97166760
(3S,4S)-3-[(4-chlorophenyl)methyl]-N,N-dimethyloxane-4-sulfonamide (PubChem CID 97166760) has the molecular formula C14H20ClNO3S and a molecular weight of 317.84 g/mol. Its IUPAC name is (3S,4S)-3-[(4-chlorophenyl)methyl]-N,N-dimethyloxane-4-sulfonamide.
| Compound Name | (3S,4S)-3-[(4-chlorophenyl)methyl]-N,N-dimethyloxane-4-sulfonamide |
|---|---|
| PubChem CID | 97166760 |
| Molecular Formula | C14H20ClNO3S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | (3S,4S)-3-[(4-chlorophenyl)methyl]-N,N-dimethyloxane-4-sulfonamide |
| SMILES | CN(C)S(=O)(=O)[C@H]1CCOC[C@@H]1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H20ClNO3S/c1-16(2)20(17,18)14-7-8-19-10-12(14)9-11-3-5-13(15)6-4-11/h3-6,12,14H,7-10H2,1-2H3/t12-,14-/m0/s1 |
| InChIKey | RDRIJCGCRRFSKL-JSGCOSHPSA-N |
| XLogP | 2.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |