C12H16ClNO3S — CID 97169032
(3R,4R)-3-[(4-chlorophenyl)methyl]oxane-4-sulfonamide (PubChem CID 97169032) has the molecular formula C12H16ClNO3S and a molecular weight of 289.78 g/mol. Its IUPAC name is (3R,4R)-3-[(4-chlorophenyl)methyl]oxane-4-sulfonamide.
| Compound Name | (3R,4R)-3-[(4-chlorophenyl)methyl]oxane-4-sulfonamide |
|---|---|
| PubChem CID | 97169032 |
| Molecular Formula | C12H16ClNO3S |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | (3R,4R)-3-[(4-chlorophenyl)methyl]oxane-4-sulfonamide |
| SMILES | NS(=O)(=O)[C@@H]1CCOC[C@H]1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H16ClNO3S/c13-11-3-1-9(2-4-11)7-10-8-17-6-5-12(10)18(14,15)16/h1-4,10,12H,5-8H2,(H2,14,15,16)/t10-,12-/m1/s1 |
| InChIKey | MFKSCMYDCZUZBO-ZYHUDNBSSA-N |
| XLogP | 1.58 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |