C12H16FNO3S — CID 97169046
(3R,4S)-3-[(3-fluorophenyl)methyl]oxane-4-sulfonamide (PubChem CID 97169046) has the molecular formula C12H16FNO3S and a molecular weight of 273.33 g/mol. Its IUPAC name is (3R,4S)-3-[(3-fluorophenyl)methyl]oxane-4-sulfonamide.
| Compound Name | (3R,4S)-3-[(3-fluorophenyl)methyl]oxane-4-sulfonamide |
|---|---|
| PubChem CID | 97169046 |
| Molecular Formula | C12H16FNO3S |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | (3R,4S)-3-[(3-fluorophenyl)methyl]oxane-4-sulfonamide |
| SMILES | NS(=O)(=O)[C@H]1CCOC[C@H]1Cc1cccc(F)c1 |
| InChI | InChI=1S/C12H16FNO3S/c13-11-3-1-2-9(7-11)6-10-8-17-5-4-12(10)18(14,15)16/h1-3,7,10,12H,4-6,8H2,(H2,14,15,16)/t10-,12+/m1/s1 |
| InChIKey | FNIWSIJTYYXMAE-PWSUYJOCSA-N |
| XLogP | 1.06 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |