C12H15FO2 — CID 71649867
3-[(3-fluorophenyl)methyl]oxan-4-ol (PubChem CID 71649867) has the molecular formula C12H15FO2 and a molecular weight of 210.25 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)methyl]oxan-4-ol.
| Compound Name | 3-[(3-fluorophenyl)methyl]oxan-4-ol |
|---|---|
| PubChem CID | 71649867 |
| Molecular Formula | C12H15FO2 |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 3-[(3-fluorophenyl)methyl]oxan-4-ol |
| SMILES | OC1CCOCC1Cc1cccc(F)c1 |
| InChI | InChI=1S/C12H15FO2/c13-11-3-1-2-9(7-11)6-10-8-15-5-4-12(10)14/h1-3,7,10,12,14H,4-6,8H2 |
| InChIKey | AAZGDJMOXOLIAJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |