C12H15ClOS — CID 97169900
(3R,4S)-3-[(4-chlorophenyl)methyl]oxane-4-thiol (PubChem CID 97169900) has the molecular formula C12H15ClOS and a molecular weight of 242.77 g/mol. Its IUPAC name is (3R,4S)-3-[(4-chlorophenyl)methyl]oxane-4-thiol.
| Compound Name | (3R,4S)-3-[(4-chlorophenyl)methyl]oxane-4-thiol |
|---|---|
| PubChem CID | 97169900 |
| Molecular Formula | C12H15ClOS |
| Molecular Weight | 242.77 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | (3R,4S)-3-[(4-chlorophenyl)methyl]oxane-4-thiol |
| SMILES | S[C@H]1CCOC[C@H]1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H15ClOS/c13-11-3-1-9(2-4-11)7-10-8-14-6-5-12(10)15/h1-4,10,12,15H,5-8H2/t10-,12+/m1/s1 |
| InChIKey | XUIJBIMQCKFDJE-PWSUYJOCSA-N |
| XLogP | 3.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.77 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|