About 4-[[(3S,4S)-4-sulfanyloxan-3-yl]methyl]benzonitrile
4-[[(3S,4S)-4-sulfanyloxan-3-yl]methyl]benzonitrile (PubChem CID 97169893) has the molecular formula C13H15NOS
and a molecular weight of 233.34 g/mol. Its IUPAC name is 4-[[(3S,4S)-4-sulfanyloxan-3-yl]methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[(3S,4S)-4-sulfanyloxan-3-yl]methyl]benzonitrile |
| PubChem CID | 97169893 |
| Molecular Formula | C13H15NOS |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 4-[[(3S,4S)-4-sulfanyloxan-3-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(C[C@H]2COCC[C@@H]2S)cc1 |
| InChI | InChI=1S/C13H15NOS/c14-8-11-3-1-10(2-4-11)7-12-9-15-6-5-13(12)16/h1-4,12-13,16H,5-7,9H2/t12-,13-/m0/s1 |
| InChIKey | NLJZLAJWCNBYTB-STQMWFEESA-N |
| XLogP | 2.44 |
| TPSA | 33.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(3S,4S)-4-sulfanyloxan-3-yl]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3S,4S)-4-sulfanyloxan-3-yl]methyl]benzonitrile?
The IUPAC name of 4-[[(3S,4S)-4-sulfanyloxan-3-yl]methyl]benzonitrile (CID 97169893) is 4-[[(3S,4S)-4-sulfanyloxan-3-yl]methyl]benzonitrile.
What is the SMILES notation for 4-[[(3S,4S)-4-sulfanyloxan-3-yl]methyl]benzonitrile?
The canonical SMILES for 4-[[(3S,4S)-4-sulfanyloxan-3-yl]methyl]benzonitrile is N#Cc1ccc(C[C@H]2COCC[C@@H]2S)cc1.
What is the InChIKey of 4-[[(3S,4S)-4-sulfanyloxan-3-yl]methyl]benzonitrile?
The InChIKey is NLJZLAJWCNBYTB-STQMWFEESA-N. The full InChI is InChI=1S/C13H15NOS/c14-8-11-3-1-10(2-4-11)7-12-9-15-6-5-13(12)16/h1-4,12-13,16H,5-7,9H2/t12-,13-/m0/s1.
What are the key properties of 4-[[(3S,4S)-4-sulfanyloxan-3-yl]methyl]benzonitrile?
4-[[(3S,4S)-4-sulfanyloxan-3-yl]methyl]benzonitrile has a molecular weight of 233.34 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3S,4S)-4-sulfanyloxan-3-yl]methyl]benzonitrile is sourced from PubChem (CID 97169893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).