C13H16N2O — CID 97168908
4-[[(3S,4S)-4-aminooxan-3-yl]methyl]benzonitrile (PubChem CID 97168908) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 4-[[(3S,4S)-4-aminooxan-3-yl]methyl]benzonitrile.
| Compound Name | 4-[[(3S,4S)-4-aminooxan-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 97168908 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 4-[[(3S,4S)-4-aminooxan-3-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(C[C@@H]2COCC[C@@H]2N)cc1 |
| InChI | InChI=1S/C13H16N2O/c14-8-11-3-1-10(2-4-11)7-12-9-16-6-5-13(12)15/h1-4,12-13H,5-7,9,15H2/t12-,13+/m1/s1 |
| InChIKey | XGMBHKYEJABGDU-OLZOCXBDSA-N |
| XLogP | 1.46 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |