About 4-[[(3S,4R)-4-(methylamino)oxan-3-yl]methyl]benzonitrile
4-[[(3S,4R)-4-(methylamino)oxan-3-yl]methyl]benzonitrile (PubChem CID 97167867) has the molecular formula C14H18N2O
and a molecular weight of 230.31 g/mol. Its IUPAC name is 4-[[(3S,4R)-4-(methylamino)oxan-3-yl]methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[(3S,4R)-4-(methylamino)oxan-3-yl]methyl]benzonitrile |
| PubChem CID | 97167867 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 4-[[(3S,4R)-4-(methylamino)oxan-3-yl]methyl]benzonitrile |
| SMILES | CN[C@@H]1CCOC[C@H]1Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H18N2O/c1-16-14-6-7-17-10-13(14)8-11-2-4-12(9-15)5-3-11/h2-5,13-14,16H,6-8,10H2,1H3/t13-,14-/m1/s1 |
| InChIKey | CNNOUORXMZSENV-ZIAGYGMSSA-N |
| XLogP | 1.73 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[(3S,4R)-4-(methylamino)oxan-3-yl]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3S,4R)-4-(methylamino)oxan-3-yl]methyl]benzonitrile?
The IUPAC name of 4-[[(3S,4R)-4-(methylamino)oxan-3-yl]methyl]benzonitrile (CID 97167867) is 4-[[(3S,4R)-4-(methylamino)oxan-3-yl]methyl]benzonitrile.
What is the SMILES notation for 4-[[(3S,4R)-4-(methylamino)oxan-3-yl]methyl]benzonitrile?
The canonical SMILES for 4-[[(3S,4R)-4-(methylamino)oxan-3-yl]methyl]benzonitrile is CN[C@@H]1CCOC[C@H]1Cc1ccc(C#N)cc1.
What is the InChIKey of 4-[[(3S,4R)-4-(methylamino)oxan-3-yl]methyl]benzonitrile?
The InChIKey is CNNOUORXMZSENV-ZIAGYGMSSA-N. The full InChI is InChI=1S/C14H18N2O/c1-16-14-6-7-17-10-13(14)8-11-2-4-12(9-15)5-3-11/h2-5,13-14,16H,6-8,10H2,1H3/t13-,14-/m1/s1.
What are the key properties of 4-[[(3S,4R)-4-(methylamino)oxan-3-yl]methyl]benzonitrile?
4-[[(3S,4R)-4-(methylamino)oxan-3-yl]methyl]benzonitrile has a molecular weight of 230.31 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3S,4R)-4-(methylamino)oxan-3-yl]methyl]benzonitrile is sourced from PubChem (CID 97167867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).