C12H14ClFOS — CID 97168653
(3S,4S)-3-[(2-chloro-6-fluorophenyl)methyl]oxane-4-thiol (PubChem CID 97168653) has the molecular formula C12H14ClFOS and a molecular weight of 260.76 g/mol. Its IUPAC name is (3S,4S)-3-[(2-chloro-6-fluorophenyl)methyl]oxane-4-thiol.
| Compound Name | (3S,4S)-3-[(2-chloro-6-fluorophenyl)methyl]oxane-4-thiol |
|---|---|
| PubChem CID | 97168653 |
| Molecular Formula | C12H14ClFOS |
| Molecular Weight | 260.76 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | (3S,4S)-3-[(2-chloro-6-fluorophenyl)methyl]oxane-4-thiol |
| SMILES | Fc1cccc(Cl)c1C[C@H]1COCC[C@@H]1S |
| InChI | InChI=1S/C12H14ClFOS/c13-10-2-1-3-11(14)9(10)6-8-7-15-5-4-12(8)16/h1-3,8,12,16H,4-7H2/t8-,12-/m0/s1 |
| InChIKey | MQFLAMQLXUSITE-UFBFGSQYSA-N |
| XLogP | 3.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.76 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|