About 4-chloro-3-[(2,6-dichlorophenyl)methyl]oxane
4-chloro-3-[(2,6-dichlorophenyl)methyl]oxane (PubChem CID 106471526) has the molecular formula C12H13Cl3O
and a molecular weight of 279.59 g/mol. Its IUPAC name is 4-chloro-3-[(2,6-dichlorophenyl)methyl]oxane.
Molecular Properties
| Compound Name | 4-chloro-3-[(2,6-dichlorophenyl)methyl]oxane |
| PubChem CID | 106471526 |
| Molecular Formula | C12H13Cl3O |
| Molecular Weight | 279.59 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 4-chloro-3-[(2,6-dichlorophenyl)methyl]oxane |
| SMILES | Clc1cccc(Cl)c1CC1COCCC1Cl |
| InChI | InChI=1S/C12H13Cl3O/c13-10-4-5-16-7-8(10)6-9-11(14)2-1-3-12(9)15/h1-3,8,10H,4-7H2 |
| InChIKey | NISWIWWFSFDHQL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-[(2,6-dichlorophenyl)methyl]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-[(2,6-dichlorophenyl)methyl]oxane?
The IUPAC name of 4-chloro-3-[(2,6-dichlorophenyl)methyl]oxane (CID 106471526) is 4-chloro-3-[(2,6-dichlorophenyl)methyl]oxane.
What is the SMILES notation for 4-chloro-3-[(2,6-dichlorophenyl)methyl]oxane?
The canonical SMILES for 4-chloro-3-[(2,6-dichlorophenyl)methyl]oxane is Clc1cccc(Cl)c1CC1COCCC1Cl.
What is the InChIKey of 4-chloro-3-[(2,6-dichlorophenyl)methyl]oxane?
The InChIKey is NISWIWWFSFDHQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Cl3O/c13-10-4-5-16-7-8(10)6-9-11(14)2-1-3-12(9)15/h1-3,8,10H,4-7H2.
What are the key properties of 4-chloro-3-[(2,6-dichlorophenyl)methyl]oxane?
4-chloro-3-[(2,6-dichlorophenyl)methyl]oxane has a molecular weight of 279.59 g/mol, XLogP of 4.18, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-[(2,6-dichlorophenyl)methyl]oxane is sourced from PubChem (CID 106471526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).