C12H13Cl3O — CID 106471526
4-chloro-3-[(2,6-dichlorophenyl)methyl]oxane (PubChem CID 106471526) has the molecular formula C12H13Cl3O and a molecular weight of 279.59 g/mol. Its IUPAC name is 4-chloro-3-[(2,6-dichlorophenyl)methyl]oxane.
| Compound Name | 4-chloro-3-[(2,6-dichlorophenyl)methyl]oxane |
|---|---|
| PubChem CID | 106471526 |
| Molecular Formula | C12H13Cl3O |
| Molecular Weight | 279.59 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 4-chloro-3-[(2,6-dichlorophenyl)methyl]oxane |
| SMILES | Clc1cccc(Cl)c1CC1COCCC1Cl |
| InChI | InChI=1S/C12H13Cl3O/c13-10-4-5-16-7-8(10)6-9-11(14)2-1-3-12(9)15/h1-3,8,10H,4-7H2 |
| InChIKey | NISWIWWFSFDHQL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|