C11H11Cl3S — CID 83191555
3-chloro-4-[(2,6-dichlorophenyl)methyl]thiolane (PubChem CID 83191555) has the molecular formula C11H11Cl3S and a molecular weight of 281.63 g/mol. Its IUPAC name is 3-chloro-4-[(2,6-dichlorophenyl)methyl]thiolane.
| Compound Name | 3-chloro-4-[(2,6-dichlorophenyl)methyl]thiolane |
|---|---|
| PubChem CID | 83191555 |
| Molecular Formula | C11H11Cl3S |
| Molecular Weight | 281.63 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | 3-chloro-4-[(2,6-dichlorophenyl)methyl]thiolane |
| SMILES | Clc1cccc(Cl)c1CC1CSCC1Cl |
| InChI | InChI=1S/C11H11Cl3S/c12-9-2-1-3-10(13)8(9)4-7-5-15-6-11(7)14/h1-3,7,11H,4-6H2 |
| InChIKey | RMAOCNKHGZHUBO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.63 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|