C11H14O2 — CID 12910406
2-benzyl-1,4-dioxane (PubChem CID 12910406) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-benzyl-1,4-dioxane.
| Compound Name | 2-benzyl-1,4-dioxane |
|---|---|
| PubChem CID | 12910406 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 2-benzyl-1,4-dioxane |
| SMILES | c1ccc(CC2COCCO2)cc1 |
| InChI | InChI=1S/C11H14O2/c1-2-4-10(5-3-1)8-11-9-12-6-7-13-11/h1-5,11H,6-9H2 |
| InChIKey | ASFXYZUOJIMOGD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |