About 2-benzyl-1,5,3-dioxazepane
2-benzyl-1,5,3-dioxazepane (PubChem CID 142764649) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-benzyl-1,5,3-dioxazepane.
Molecular Properties
| Compound Name | 2-benzyl-1,5,3-dioxazepane |
| PubChem CID | 142764649 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-benzyl-1,5,3-dioxazepane |
| SMILES | c1ccc(CC2NCOCCO2)cc1 |
| InChI | InChI=1S/C11H15NO2/c1-2-4-10(5-3-1)8-11-12-9-13-6-7-14-11/h1-5,11-12H,6-9H2 |
| InChIKey | SDHVPPBUSXNKMX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzyl-1,5,3-dioxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1,5,3-dioxazepane?
The IUPAC name of 2-benzyl-1,5,3-dioxazepane (CID 142764649) is 2-benzyl-1,5,3-dioxazepane.
What is the SMILES notation for 2-benzyl-1,5,3-dioxazepane?
The canonical SMILES for 2-benzyl-1,5,3-dioxazepane is c1ccc(CC2NCOCCO2)cc1.
What is the InChIKey of 2-benzyl-1,5,3-dioxazepane?
The InChIKey is SDHVPPBUSXNKMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-2-4-10(5-3-1)8-11-12-9-13-6-7-14-11/h1-5,11-12H,6-9H2.
What are the key properties of 2-benzyl-1,5,3-dioxazepane?
2-benzyl-1,5,3-dioxazepane has a molecular weight of 193.25 g/mol, XLogP of 1.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1,5,3-dioxazepane is sourced from PubChem (CID 142764649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).