C11H15NO2 — CID 142764649
2-benzyl-1,5,3-dioxazepane (PubChem CID 142764649) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-benzyl-1,5,3-dioxazepane.
| Compound Name | 2-benzyl-1,5,3-dioxazepane |
|---|---|
| PubChem CID | 142764649 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-benzyl-1,5,3-dioxazepane |
| SMILES | c1ccc(CC2NCOCCO2)cc1 |
| InChI | InChI=1S/C11H15NO2/c1-2-4-10(5-3-1)8-11-12-9-13-6-7-14-11/h1-5,11-12H,6-9H2 |
| InChIKey | SDHVPPBUSXNKMX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |