C11H16ClNO — CID 117225781
2-[(4-methylphenyl)methyl]-1,3-oxazolidine;hydrochloride (PubChem CID 117225781) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methyl]-1,3-oxazolidine;hydrochloride.
| Compound Name | 2-[(4-methylphenyl)methyl]-1,3-oxazolidine;hydrochloride |
|---|---|
| PubChem CID | 117225781 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-[(4-methylphenyl)methyl]-1,3-oxazolidine;hydrochloride |
| SMILES | Cc1ccc(CC2NCCO2)cc1.Cl |
| InChI | InChI=1S/C11H15NO.ClH/c1-9-2-4-10(5-3-9)8-11-12-6-7-13-11;/h2-5,11-12H,6-8H2,1H3;1H |
| InChIKey | PMOCKNUMCIYMRW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |