C22H26N2O3 — CID 100984884
(3aS,4R,8R,8aS)-4,8-bis[(4-methylphenyl)methyl]-3a,4,5,7,8,8a-hexahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-6-one (PubChem CID 100984884) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is (3aS,4R,8R,8aS)-4,8-bis[(4-methylphenyl)methyl]-3a,4,5,7,8,8a-hexahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-6-one.
| Compound Name | (3aS,4R,8R,8aS)-4,8-bis[(4-methylphenyl)methyl]-3a,4,5,7,8,8a-hexahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-6-one |
|---|---|
| PubChem CID | 100984884 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (3aS,4R,8R,8aS)-4,8-bis[(4-methylphenyl)methyl]-3a,4,5,7,8,8a-hexahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-6-one |
| SMILES | Cc1ccc(C[C@H]2NC(=O)N[C@H](Cc3ccc(C)cc3)[C@@H]3OCO[C@H]32)cc1 |
| InChI | InChI=1S/C22H26N2O3/c1-14-3-7-16(8-4-14)11-18-20-21(27-13-26-20)19(24-22(25)23-18)12-17-9-5-15(2)6-10-17/h3-10,18-21H,11-13H2,1-2H3,(H2,23,24,25)/t18-,19-,20+,21+/m1/s1 |
| InChIKey | BPUKRNFTSQEQJK-CGXNFDGLSA-N |
| XLogP | 2.88 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |