About 2-benzyl-1,3-oxazepane
2-benzyl-1,3-oxazepane (PubChem CID 67179669) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 2-benzyl-1,3-oxazepane.
Molecular Properties
| Compound Name | 2-benzyl-1,3-oxazepane |
| PubChem CID | 67179669 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2-benzyl-1,3-oxazepane |
| SMILES | c1ccc(CC2NCCCCO2)cc1 |
| InChI | InChI=1S/C12H17NO/c1-2-6-11(7-3-1)10-12-13-8-4-5-9-14-12/h1-3,6-7,12-13H,4-5,8-10H2 |
| InChIKey | DHPRHGRUWGAHLW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-1,3-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1,3-oxazepane?
The IUPAC name of 2-benzyl-1,3-oxazepane (CID 67179669) is 2-benzyl-1,3-oxazepane.
What is the SMILES notation for 2-benzyl-1,3-oxazepane?
The canonical SMILES for 2-benzyl-1,3-oxazepane is c1ccc(CC2NCCCCO2)cc1.
What is the InChIKey of 2-benzyl-1,3-oxazepane?
The InChIKey is DHPRHGRUWGAHLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-2-6-11(7-3-1)10-12-13-8-4-5-9-14-12/h1-3,6-7,12-13H,4-5,8-10H2.
What are the key properties of 2-benzyl-1,3-oxazepane?
2-benzyl-1,3-oxazepane has a molecular weight of 191.27 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1,3-oxazepane is sourced from PubChem (CID 67179669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).