C12H17NO — CID 67179669
2-benzyl-1,3-oxazepane (PubChem CID 67179669) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 2-benzyl-1,3-oxazepane.
| Compound Name | 2-benzyl-1,3-oxazepane |
|---|---|
| PubChem CID | 67179669 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2-benzyl-1,3-oxazepane |
| SMILES | c1ccc(CC2NCCCCO2)cc1 |
| InChI | InChI=1S/C12H17NO/c1-2-6-11(7-3-1)10-12-13-8-4-5-9-14-12/h1-3,6-7,12-13H,4-5,8-10H2 |
| InChIKey | DHPRHGRUWGAHLW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |