C11H16ClNO — CID 167721837
(3R)-3-phenyl-1,4-oxazepane;hydrochloride (PubChem CID 167721837) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is (3R)-3-phenyl-1,4-oxazepane;hydrochloride.
| Compound Name | (3R)-3-phenyl-1,4-oxazepane;hydrochloride |
|---|---|
| PubChem CID | 167721837 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | (3R)-3-phenyl-1,4-oxazepane;hydrochloride |
| SMILES | Cl.c1ccc([C@@H]2COCCCN2)cc1 |
| InChI | InChI=1S/C11H15NO.ClH/c1-2-5-10(6-3-1)11-9-13-8-4-7-12-11;/h1-3,5-6,11-12H,4,7-9H2;1H/t11-;/m0./s1 |
| InChIKey | WUVZKFRXPUJCSP-MERQFXBCSA-N |
| XLogP | 2.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |