About 9-benzyl-5,8-dioxa-1-azaspiro[3.5]nonane
9-benzyl-5,8-dioxa-1-azaspiro[3.5]nonane (PubChem CID 70380941) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is 9-benzyl-5,8-dioxa-1-azaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 9-benzyl-5,8-dioxa-1-azaspiro[3.5]nonane |
| PubChem CID | 70380941 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 9-benzyl-5,8-dioxa-1-azaspiro[3.5]nonane |
| SMILES | c1ccc(CC2OCCOC23CCN3)cc1 |
| InChI | InChI=1S/C13H17NO2/c1-2-4-11(5-3-1)10-12-13(6-7-14-13)16-9-8-15-12/h1-5,12,14H,6-10H2 |
| InChIKey | MUHPARYOLSDSHV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-benzyl-5,8-dioxa-1-azaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-benzyl-5,8-dioxa-1-azaspiro[3.5]nonane?
The IUPAC name of 9-benzyl-5,8-dioxa-1-azaspiro[3.5]nonane (CID 70380941) is 9-benzyl-5,8-dioxa-1-azaspiro[3.5]nonane.
What is the SMILES notation for 9-benzyl-5,8-dioxa-1-azaspiro[3.5]nonane?
The canonical SMILES for 9-benzyl-5,8-dioxa-1-azaspiro[3.5]nonane is c1ccc(CC2OCCOC23CCN3)cc1.
What is the InChIKey of 9-benzyl-5,8-dioxa-1-azaspiro[3.5]nonane?
The InChIKey is MUHPARYOLSDSHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c1-2-4-11(5-3-1)10-12-13(6-7-14-13)16-9-8-15-12/h1-5,12,14H,6-10H2.
What are the key properties of 9-benzyl-5,8-dioxa-1-azaspiro[3.5]nonane?
9-benzyl-5,8-dioxa-1-azaspiro[3.5]nonane has a molecular weight of 219.28 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-benzyl-5,8-dioxa-1-azaspiro[3.5]nonane is sourced from PubChem (CID 70380941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).