C18H20BrNO — CID 175575525
2,3-dibenzyl-2-bromomorpholine (PubChem CID 175575525) has the molecular formula C18H20BrNO and a molecular weight of 346.27 g/mol. Its IUPAC name is 2,3-dibenzyl-2-bromomorpholine.
| Compound Name | 2,3-dibenzyl-2-bromomorpholine |
|---|---|
| PubChem CID | 175575525 |
| Molecular Formula | C18H20BrNO |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 2,3-dibenzyl-2-bromomorpholine |
| SMILES | BrC1(Cc2ccccc2)OCCNC1Cc1ccccc1 |
| InChI | InChI=1S/C18H20BrNO/c19-18(14-16-9-5-2-6-10-16)17(20-11-12-21-18)13-15-7-3-1-4-8-15/h1-10,17,20H,11-14H2 |
| InChIKey | GTAPWLMIAYMNIO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|