About 8-benzyl-1,4-dioxa-7,10-dithiacyclododecane
8-benzyl-1,4-dioxa-7,10-dithiacyclododecane (PubChem CID 71445141) has the molecular formula C15H22O2S2
and a molecular weight of 298.47 g/mol. Its IUPAC name is 8-benzyl-1,4-dioxa-7,10-dithiacyclododecane.
Molecular Properties
| Compound Name | 8-benzyl-1,4-dioxa-7,10-dithiacyclododecane |
| PubChem CID | 71445141 |
| Molecular Formula | C15H22O2S2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 8-benzyl-1,4-dioxa-7,10-dithiacyclododecane |
| SMILES | c1ccc(CC2CSCCOCCOCCS2)cc1 |
| InChI | InChI=1S/C15H22O2S2/c1-2-4-14(5-3-1)12-15-13-18-10-8-16-6-7-17-9-11-19-15/h1-5,15H,6-13H2 |
| InChIKey | OSFBQSFFILOMBI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-benzyl-1,4-dioxa-7,10-dithiacyclododecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-benzyl-1,4-dioxa-7,10-dithiacyclododecane?
The IUPAC name of 8-benzyl-1,4-dioxa-7,10-dithiacyclododecane (CID 71445141) is 8-benzyl-1,4-dioxa-7,10-dithiacyclododecane.
What is the SMILES notation for 8-benzyl-1,4-dioxa-7,10-dithiacyclododecane?
The canonical SMILES for 8-benzyl-1,4-dioxa-7,10-dithiacyclododecane is c1ccc(CC2CSCCOCCOCCS2)cc1.
What is the InChIKey of 8-benzyl-1,4-dioxa-7,10-dithiacyclododecane?
The InChIKey is OSFBQSFFILOMBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O2S2/c1-2-4-14(5-3-1)12-15-13-18-10-8-16-6-7-17-9-11-19-15/h1-5,15H,6-13H2.
What are the key properties of 8-benzyl-1,4-dioxa-7,10-dithiacyclododecane?
8-benzyl-1,4-dioxa-7,10-dithiacyclododecane has a molecular weight of 298.47 g/mol, XLogP of 3.11, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-benzyl-1,4-dioxa-7,10-dithiacyclododecane is sourced from PubChem (CID 71445141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).