C26H36O5S2 — CID 10696477
trans-(2R,3R)-2,3-bis(benzylsulfanylmethyl)-1,4,7,10,13-pentaoxacyclopentadecane (PubChem CID 10696477) has the molecular formula C26H36O5S2 and a molecular weight of 492.70 g/mol. Its IUPAC name is trans-(2R,3R)-2,3-bis(benzylsulfanylmethyl)-1,4,7,10,13-pentaoxacyclopentadecane.
| Compound Name | trans-(2R,3R)-2,3-bis(benzylsulfanylmethyl)-1,4,7,10,13-pentaoxacyclopentadecane |
|---|---|
| PubChem CID | 10696477 |
| Molecular Formula | C26H36O5S2 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | trans-(2R,3R)-2,3-bis(benzylsulfanylmethyl)-1,4,7,10,13-pentaoxacyclopentadecane |
| SMILES | c1ccc(CSC[C@@H]2OCCOCCOCCOCCO[C@H]2CSCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H36O5S2/c1-3-7-23(8-4-1)19-32-21-25-26(22-33-20-24-9-5-2-6-10-24)31-18-16-29-14-12-27-11-13-28-15-17-30-25/h1-10,25-26H,11-22H2/t25-,26-/m0/s1 |
| InChIKey | QFXHKOXGKOSWBA-UIOOFZCWSA-N |
| XLogP | 4.69 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |