C52H52N4O16 — CID 99693408
2-[[(2R,3R,14S,15R)-3,14,15-tris[(1,3-dioxoisoindol-2-yl)methyl]-1,4,7,10,13,16,19,22-octaoxacyclotetracos-2-yl]methyl]isoindole-1,3-dione (PubChem CID 99693408) has the molecular formula C52H52N4O16 and a molecular weight of 989.00 g/mol. Its IUPAC name is 2-[[(2R,3R,14S,15R)-3,14,15-tris[(1,3-dioxoisoindol-2-yl)methyl]-1,4,7,10,13,16,19,22-octaoxacyclotetracos-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(2R,3R,14S,15R)-3,14,15-tris[(1,3-dioxoisoindol-2-yl)methyl]-1,4,7,10,13,16,19,22-octaoxacyclotetracos-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 99693408 |
| Molecular Formula | C52H52N4O16 |
| Molecular Weight | 989.00 g/mol |
| Exact Mass | 988.34 |
| IUPAC Name | 2-[[(2R,3R,14S,15R)-3,14,15-tris[(1,3-dioxoisoindol-2-yl)methyl]-1,4,7,10,13,16,19,22-octaoxacyclotetracos-2-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@@H]1OCCOCCOCCO[C@H](CN2C(=O)c3ccccc3C2=O)[C@@H](CN2C(=O)c3ccccc3C2=O)OCCOCCOCCO[C@@H]1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C52H52N4O16/c57-45-33-9-1-2-10-34(33)46(58)53(45)29-41-42(30-54-47(59)35-11-3-4-12-36(35)48(54)60)70-26-22-66-19-20-68-24-28-72-44(32-56-51(63)39-15-7-8-16-40(39)52(56)64)43(71-27-23-67-18-17-65-21-25-69-41)31-55-49(61)37-13-5-6-14-38(37)50(55)62/h1-16,41-44H,17-32H2/t41-,42-,43-,44+/m1/s1 |
| InChIKey | NPLASEGDXFYLME-YMZAAHCZSA-N |
| XLogP | 2.79 |
| TPSA | 223.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 989.00 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|