C13H15NO3 — CID 160821291
2-ethylisoindole-1,3-dione;2-methyloxirane (PubChem CID 160821291) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-ethylisoindole-1,3-dione;2-methyloxirane.
| Compound Name | 2-ethylisoindole-1,3-dione;2-methyloxirane |
|---|---|
| PubChem CID | 160821291 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 2-ethylisoindole-1,3-dione;2-methyloxirane |
| SMILES | CC1CO1.CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C10H9NO2.C3H6O/c1-2-11-9(12)7-5-3-4-6-8(7)10(11)13;1-3-2-4-3/h3-6H,2H2,1H3;3H,2H2,1H3 |
| InChIKey | SFOVNPMWEOPRDY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|