C11H13NO2 — CID 125490718
(2S)-3-ethyl-2-methyl-2H-1,3-benzoxazin-4-one (PubChem CID 125490718) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is (2S)-3-ethyl-2-methyl-2H-1,3-benzoxazin-4-one.
| Compound Name | (2S)-3-ethyl-2-methyl-2H-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 125490718 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (2S)-3-ethyl-2-methyl-2H-1,3-benzoxazin-4-one |
| SMILES | CCN1C(=O)c2ccccc2O[C@H]1C |
| InChI | InChI=1S/C11H13NO2/c1-3-12-8(2)14-10-7-5-4-6-9(10)11(12)13/h4-8H,3H2,1-2H3/t8-/m0/s1 |
| InChIKey | RFNWUNPOIYWLEH-QMMMGPOBSA-N |
| XLogP | 1.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |