C10H10O3 — CID 7177147
(2R,3R)-2-hydroxy-3-methyl-2,3-dihydrochromen-4-one (PubChem CID 7177147) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is (2R,3R)-2-hydroxy-3-methyl-2,3-dihydrochromen-4-one.
| Compound Name | (2R,3R)-2-hydroxy-3-methyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 7177147 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | (2R,3R)-2-hydroxy-3-methyl-2,3-dihydrochromen-4-one |
| SMILES | C[C@H]1C(=O)c2ccccc2O[C@H]1O |
| InChI | InChI=1S/C10H10O3/c1-6-9(11)7-4-2-3-5-8(7)13-10(6)12/h2-6,10,12H,1H3/t6-,10+/m0/s1 |
| InChIKey | BDQFZKDKPMDPMY-QUBYGPBYSA-N |
| XLogP | 1.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |