C10H9BrO2 — CID 15266075
(2S,3R)-3-bromo-2-methyl-2,3-dihydrochromen-4-one (PubChem CID 15266075) has the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. Its IUPAC name is (2S,3R)-3-bromo-2-methyl-2,3-dihydrochromen-4-one.
| Compound Name | (2S,3R)-3-bromo-2-methyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 15266075 |
| Molecular Formula | C10H9BrO2 |
| Molecular Weight | 241.08 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | (2S,3R)-3-bromo-2-methyl-2,3-dihydrochromen-4-one |
| SMILES | C[C@@H]1Oc2ccccc2C(=O)[C@@H]1Br |
| InChI | InChI=1S/C10H9BrO2/c1-6-9(11)10(12)7-4-2-3-5-8(7)13-6/h2-6,9H,1H3/t6-,9+/m0/s1 |
| InChIKey | OEAVIKWQRKHRTG-IMTBSYHQSA-N |
| XLogP | 2.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.08 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|