About chromen-4-one
chromen-4-one (PubChem CID 10286) has the molecular formula C9H6O2
and a molecular weight of 146.14 g/mol. Its IUPAC name is chromen-4-one.
Molecular Properties
| Compound Name | chromen-4-one |
| PubChem CID | 10286 |
| Molecular Formula | C9H6O2 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | chromen-4-one |
| SMILES | O=c1ccoc2ccccc12 |
| InChI | InChI=1S/C9H6O2/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-6H |
| InChIKey | OTAFHZMPRISVEM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromen-4-one?
The IUPAC name of chromen-4-one (CID 10286) is chromen-4-one.
What is the SMILES notation for chromen-4-one?
The canonical SMILES for chromen-4-one is O=c1ccoc2ccccc12.
What is the InChIKey of chromen-4-one?
The InChIKey is OTAFHZMPRISVEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O2/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-6H.
What are the key properties of chromen-4-one?
chromen-4-one has a molecular weight of 146.14 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chromen-4-one is sourced from PubChem (CID 10286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).