About Chromone
Chromone (PubChem CID 10286) has the molecular formula C9H6O2
and a molecular weight of 146.14 g/mol. Its IUPAC name is chromen-4-one.
Molecular Properties
| Compound Name | Chromone |
| PubChem CID | 10286 |
| Molecular Formula | C9H6O2 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | chromen-4-one |
| SMILES | C1=CC=C2C(=C1)C(=O)C=CO2 |
| InChI | InChI=1S/C9H6O2/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-6H |
| InChIKey | OTAFHZMPRISVEM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | 196 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Chromone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Chromone?
The IUPAC name of Chromone (CID 10286) is chromen-4-one.
What is the SMILES notation for Chromone?
The canonical SMILES for Chromone is C1=CC=C2C(=C1)C(=O)C=CO2.
What is the InChIKey of Chromone?
The InChIKey is OTAFHZMPRISVEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O2/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-6H.
What are the key properties of Chromone?
Chromone has a molecular weight of 146.14 g/mol, XLogP of 1.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Chromone is sourced from PubChem (CID 10286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).