C13H18O4 — CID 90988850
(2S,3R)-2,3-bis(hydroxymethyl)-2,3-dihydrochromen-4-one;ethane (PubChem CID 90988850) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (2S,3R)-2,3-bis(hydroxymethyl)-2,3-dihydrochromen-4-one;ethane.
| Compound Name | (2S,3R)-2,3-bis(hydroxymethyl)-2,3-dihydrochromen-4-one;ethane |
|---|---|
| PubChem CID | 90988850 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (2S,3R)-2,3-bis(hydroxymethyl)-2,3-dihydrochromen-4-one;ethane |
| SMILES | CC.O=C1c2ccccc2O[C@H](CO)[C@H]1CO |
| InChI | InChI=1S/C11H12O4.C2H6/c12-5-8-10(6-13)15-9-4-2-1-3-7(9)11(8)14;1-2/h1-4,8,10,12-13H,5-6H2;1-2H3/t8-,10-;/m1./s1 |
| InChIKey | JPXAOBPNKPOWFL-GHXDPTCOSA-N |
| XLogP | 1.26 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |